1-phenyl-1-(2-phenylcyclopropyl)ethanol
Product Code: 2226828
Molecular Formula: C17H18O
Molecular Weight: 238.32
694514-18-6
3-METHOXY-4-(TRIFLUOROMETHYL)BENZENESULFONYL CHLORIDE
710973-27-6
1-Piperidinecarboxylic acid,4-[([1,1'-biphenyl]-2-ylmethyl)(cyclohexylmethyl)amino]-,1,1-dimethylethyl ester
71213-91-7
9,10,10a,11a-tetrahydrobenzo[8,9]triphenyleno[1,2-b]oxirene-9,10-diol
70132-97-7
3-[4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenyl]-1,2-benzisothiazole hydrochloride
69298-25-5
Benzyl 2,4-dichloropyrimidine-5-carboxylate
5949-36-0
5-ethyl-5-phenylbarbituric acid, compound with 1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline (1:1)
75214-68-5
sodium bis[4-[(5-chloro-2-hydroxyphenyl)azo]naphth[2,1-d]-1,3-oxathiazol-5-ol 3,3-dioxidato(2-)]chromate(2-)
69352-76-7
(2E,4E,8E,10E,14E,18E,20E)-20-(carboxymethyl)-6-methoxy-2,5,17-trimethyldocosa-2,4,8,10,14,18,20-heptaenedioic acid
71212-10-7
LOTOS 71
589491-14-5
1,4-Cyclohexanediamine,N-(7-chloro-4-quinolinyl)-N'-(3,5-dimethylphenyl)-, cis-
693262-06-5
3-Piperidinecarboxylic acid, 1-methyl-4-phenyl-, ethyl ester,(3R,4S)-rel-
6944-91-8
S-methyl 2-(1,3-benzothiazol-2-yl)hydrazinecarbothioate
211691-09-7
1-Tridecen-7-one
69766-31-0
2-(1H-benzotriazol-1-yl)-N-(2-chloroethyl)-N-ethylethanaminium chloride
69352-81-4
1-{2-[(cyclohepta-2,4,6-trien-1-ylacetyl)oxy]ethyl}piperidinium chloride
58692-65-2
1-phenyl-1-(2-phenylcyclopropyl)ethanol
58693-19-9
PHENOBARBITAL QUINIDINE
841281-51-4
3-Piperidinecarboxamide,1-[4-cyano-6-[(2-methoxyphenyl)amino]-1,3,5-triazin-2-yl]-N,N-diethyl-
69291-24-3
4-oxo-2-phenyl-4H-3,1-benzoxathiine-8-carboxylic acid
59710-71-3
tert-butyl tetradecaneperoxoate
58692-65-2, CAS No. 58692-65-2,CasNo 58692-65-2,cas 58692-65-2
1-phenyl-1-(2-phenylcyclopropyl)ethanol