Glycine, N-(4-chloro-2-nitrophenyl)-
CAS No: 66367-04-2
Glycine
66367-04-2
glycine,chloro,nitrophenyl,66367-04-2
2025-10-22 Discover Glycine, N-(4-chloro-2-nitrophenyl)- (CAS No: 66367-04-2) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.